About potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid
potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid (PubChem CID 173069709) has the molecular formula C22H41KO4
and a molecular weight of 408.66 g/mol. Its IUPAC name is potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid |
| PubChem CID | 173069709 |
| Molecular Formula | C22H41KO4 |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid |
| SMILES | CCCCCCCCCCCCCCCCCCOC(=O)/C=C/C(=O)O.[H-].[K+] |
| InChI | InChI=1S/C22H40O4.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-26-22(25)19-18-21(23)24;;/h18-19H,2-17,20H2,1H3,(H,23,24);;/q;+1;-1/b19-18+;; |
| InChIKey | QMIKGULCTVIKLS-BUFQOAPZSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid?
The IUPAC name of potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid (CID 173069709) is potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid.
What is the SMILES notation for potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid?
The canonical SMILES for potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid is CCCCCCCCCCCCCCCCCCOC(=O)/C=C/C(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid?
The InChIKey is QMIKGULCTVIKLS-BUFQOAPZSA-N. The full InChI is InChI=1S/C22H40O4.K.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-26-22(25)19-18-21(23)24;;/h18-19H,2-17,20H2,1H3,(H,23,24);;/q;+1;-1/b19-18+;;.
What are the key properties of potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid?
potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid has a molecular weight of 408.66 g/mol, XLogP of 3.55, 19 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;(E)-4-octadecoxy-4-oxobut-2-enoic acid is sourced from PubChem (CID 173069709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).