C18H34O4Si — CID 87900135
(Z)-4-oxo-4-[5-tri(propan-2-yl)silylpentoxy]but-2-enoic acid (PubChem CID 87900135) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (Z)-4-oxo-4-[5-tri(propan-2-yl)silylpentoxy]but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[5-tri(propan-2-yl)silylpentoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 87900135 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (Z)-4-oxo-4-[5-tri(propan-2-yl)silylpentoxy]but-2-enoic acid |
| SMILES | CC(C)[Si](CCCCCOC(=O)/C=C\C(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-14(2)23(15(3)4,16(5)6)13-9-7-8-12-22-18(21)11-10-17(19)20/h10-11,14-16H,7-9,12-13H2,1-6H3,(H,19,20)/b11-10- |
| InChIKey | XBZKLKITVJMPAT-KHPPLWFESA-N |
| XLogP | 5.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|