C15H24F6O5Si2 — CID 173346718
1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) but-2-enedioate (PubChem CID 173346718) has the molecular formula C15H24F6O5Si2 and a molecular weight of 454.51 g/mol. Its IUPAC name is 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) but-2-enedioate.
| Compound Name | 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) but-2-enedioate |
|---|---|
| PubChem CID | 173346718 |
| Molecular Formula | C15H24F6O5Si2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) but-2-enedioate |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCOC(=O)C=CC(=O)OC(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H24F6O5Si2/c1-27(2,3)26-28(4,5)10-6-9-24-11(22)7-8-12(23)25-14(18,13(16)17)15(19,20)21/h7-8,13H,6,9-10H2,1-5H3 |
| InChIKey | GFENXNYDRBVXIF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|