C20H44O7Si4 — CID 173363801
3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl but-2-enoate (PubChem CID 173363801) has the molecular formula C20H44O7Si4 and a molecular weight of 508.91 g/mol. Its IUPAC name is 3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl but-2-enoate.
| Compound Name | 3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl but-2-enoate |
|---|---|
| PubChem CID | 173363801 |
| Molecular Formula | C20H44O7Si4 |
| Molecular Weight | 508.91 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 3-[[3-acetyloxypropyl(dimethyl)silyl]oxy-bis(trimethylsilyloxy)silyl]propyl but-2-enoate |
| SMILES | CC=CC(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)CCCOC(C)=O |
| InChI | InChI=1S/C20H44O7Si4/c1-11-14-20(22)24-16-13-18-31(25-28(3,4)5,26-29(6,7)8)27-30(9,10)17-12-15-23-19(2)21/h11,14H,12-13,15-18H2,1-10H3 |
| InChIKey | PSYJVHZFFCUIRK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.91 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|