C16H38O14Si4 — CID 91235537
3-[tris[tris(hydroxymethyl)silyloxy]silyl]propyl but-2-enoate (PubChem CID 91235537) has the molecular formula C16H38O14Si4 and a molecular weight of 566.81 g/mol. Its IUPAC name is 3-[tris[tris(hydroxymethyl)silyloxy]silyl]propyl but-2-enoate.
| Compound Name | 3-[tris[tris(hydroxymethyl)silyloxy]silyl]propyl but-2-enoate |
|---|---|
| PubChem CID | 91235537 |
| Molecular Formula | C16H38O14Si4 |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 3-[tris[tris(hydroxymethyl)silyloxy]silyl]propyl but-2-enoate |
| SMILES | CC=CC(=O)OCCC[Si](O[Si](CO)(CO)CO)(O[Si](CO)(CO)CO)O[Si](CO)(CO)CO |
| InChI | InChI=1S/C16H38O14Si4/c1-2-4-16(26)27-5-3-6-34(28-31(7-17,8-18)9-19,29-32(10-20,11-21)12-22)30-33(13-23,14-24)15-25/h2,4,17-25H,3,5-15H2,1H3 |
| InChIKey | SYLJCMYZVWGGNP-UHFFFAOYSA-N |
| XLogP | -4.90 |
| TPSA | 236.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | -4.90 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|