About hydroxysilane;3-trimethoxysilylpropyl but-2-enoate
hydroxysilane;3-trimethoxysilylpropyl but-2-enoate (PubChem CID 174908985) has the molecular formula C10H24O6Si2
and a molecular weight of 296.47 g/mol. Its IUPAC name is hydroxysilane;3-trimethoxysilylpropyl but-2-enoate.
Molecular Properties
| Compound Name | hydroxysilane;3-trimethoxysilylpropyl but-2-enoate |
| PubChem CID | 174908985 |
| Molecular Formula | C10H24O6Si2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | hydroxysilane;3-trimethoxysilylpropyl but-2-enoate |
| SMILES | CC=CC(=O)OCCC[Si](OC)(OC)OC.O[SiH3] |
| InChI | InChI=1S/C10H20O5Si.H4OSi/c1-5-7-10(11)15-8-6-9-16(12-2,13-3)14-4;1-2/h5,7H,6,8-9H2,1-4H3;1H,2H3 |
| InChIKey | ZBKNHPPOUNIZGP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hydroxysilane;3-trimethoxysilylpropyl but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxysilane;3-trimethoxysilylpropyl but-2-enoate?
The IUPAC name of hydroxysilane;3-trimethoxysilylpropyl but-2-enoate (CID 174908985) is hydroxysilane;3-trimethoxysilylpropyl but-2-enoate.
What is the SMILES notation for hydroxysilane;3-trimethoxysilylpropyl but-2-enoate?
The canonical SMILES for hydroxysilane;3-trimethoxysilylpropyl but-2-enoate is CC=CC(=O)OCCC[Si](OC)(OC)OC.O[SiH3].
What is the InChIKey of hydroxysilane;3-trimethoxysilylpropyl but-2-enoate?
The InChIKey is ZBKNHPPOUNIZGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5Si.H4OSi/c1-5-7-10(11)15-8-6-9-16(12-2,13-3)14-4;1-2/h5,7H,6,8-9H2,1-4H3;1H,2H3.
What are the key properties of hydroxysilane;3-trimethoxysilylpropyl but-2-enoate?
hydroxysilane;3-trimethoxysilylpropyl but-2-enoate has a molecular weight of 296.47 g/mol, XLogP of -0.37, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxysilane;3-trimethoxysilylpropyl but-2-enoate is sourced from PubChem (CID 174908985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).