C20H38O6Si2 — CID 151580287
(E)-4-[2-cyclohexyl-2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethoxy]-4-oxobut-2-enoic acid (PubChem CID 151580287) has the molecular formula C20H38O6Si2 and a molecular weight of 430.69 g/mol. Its IUPAC name is (E)-4-[2-cyclohexyl-2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-cyclohexyl-2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 151580287 |
| Molecular Formula | C20H38O6Si2 |
| Molecular Weight | 430.69 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (E)-4-[2-cyclohexyl-2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethoxy]-4-oxobut-2-enoic acid |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCOC(COC(=O)/C=C/C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C20H38O6Si2/c1-27(2,3)26-28(4,5)15-9-14-24-18(17-10-7-6-8-11-17)16-25-20(23)13-12-19(21)22/h12-13,17-18H,6-11,14-16H2,1-5H3,(H,21,22)/b13-12+ |
| InChIKey | QGIIKROVEREAEI-OUKQBFOZSA-N |
| XLogP | 4.58 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|