C24H46O9Si2 — CID 123160039
[3-[3-[[3-(3-but-2-enoyloxy-2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] but-2-enoate (PubChem CID 123160039) has the molecular formula C24H46O9Si2 and a molecular weight of 534.80 g/mol. Its IUPAC name is [3-[3-[[3-(3-but-2-enoyloxy-2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[3-[[3-(3-but-2-enoyloxy-2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 123160039 |
| Molecular Formula | C24H46O9Si2 |
| Molecular Weight | 534.80 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | [3-[3-[[3-(3-but-2-enoyloxy-2-hydroxypropoxy)propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COCCC[Si](C)(C)O[Si](C)(C)CCCOCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C24H46O9Si2/c1-7-11-23(27)31-19-21(25)17-29-13-9-15-34(3,4)33-35(5,6)16-10-14-30-18-22(26)20-32-24(28)12-8-2/h7-8,11-12,21-22,25-26H,9-10,13-20H2,1-6H3 |
| InChIKey | YOFDZCPXYUVTOZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|