C48H74O24 — CID 141469644
[2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(3-but-2-enoyloxy-2-hydroxypropoxy)hexoxy]propyl] but-2-enoate (PubChem CID 141469644) has the molecular formula C48H74O24 and a molecular weight of 1035.10 g/mol. Its IUPAC name is [2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(3-but-2-enoyloxy-2-hydroxypropoxy)hexoxy]propyl] but-2-enoate.
| Compound Name | [2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(3-but-2-enoyloxy-2-hydroxypropoxy)hexoxy]propyl] but-2-enoate |
|---|---|
| PubChem CID | 141469644 |
| Molecular Formula | C48H74O24 |
| Molecular Weight | 1035.10 g/mol |
| Exact Mass | 1034.46 |
| IUPAC Name | [2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis(3-but-2-enoyloxy-2-hydroxypropoxy)hexoxy]propyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COC[C@H](OCC(O)COC(=O)C=CC)[C@@H](OCC(O)COC(=O)C=CC)[C@H](OCC(O)COC(=O)C=CC)[C@@H](COCC(O)COC(=O)C=CC)OCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C48H74O24/c1-7-13-41(55)65-23-33(49)19-61-31-39(63-21-35(51)25-67-43(57)15-9-3)47(71-29-37(53)27-69-45(59)17-11-5)48(72-30-38(54)28-70-46(60)18-12-6)40(64-22-36(52)26-68-44(58)16-10-4)32-62-20-34(50)24-66-42(56)14-8-2/h7-18,33-40,47-54H,19-32H2,1-6H3/t33?,34?,35?,36?,37?,38?,39-,40+,47-,48-/m1/s1 |
| InChIKey | MUJXFUAJNAFNNB-AMXCYMKGSA-N |
| XLogP | -0.56 |
| TPSA | 334.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.10 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|