C33H50O17 — CID 141469611
[2-hydroxy-3-[(2R,3S,4R)-2,3,4-tris(3-but-2-enoyloxy-2-hydroxypropoxy)-5-oxopentoxy]propyl] but-2-enoate (PubChem CID 141469611) has the molecular formula C33H50O17 and a molecular weight of 718.75 g/mol. Its IUPAC name is [2-hydroxy-3-[(2R,3S,4R)-2,3,4-tris(3-but-2-enoyloxy-2-hydroxypropoxy)-5-oxopentoxy]propyl] but-2-enoate.
| Compound Name | [2-hydroxy-3-[(2R,3S,4R)-2,3,4-tris(3-but-2-enoyloxy-2-hydroxypropoxy)-5-oxopentoxy]propyl] but-2-enoate |
|---|---|
| PubChem CID | 141469611 |
| Molecular Formula | C33H50O17 |
| Molecular Weight | 718.75 g/mol |
| Exact Mass | 718.30 |
| IUPAC Name | [2-hydroxy-3-[(2R,3S,4R)-2,3,4-tris(3-but-2-enoyloxy-2-hydroxypropoxy)-5-oxopentoxy]propyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COC[C@@H](OCC(O)COC(=O)C=CC)[C@H](OCC(O)COC(=O)C=CC)[C@H](C=O)OCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C33H50O17/c1-5-9-29(39)46-17-23(35)14-43-22-28(45-16-25(37)19-48-31(41)11-7-3)33(50-21-26(38)20-49-32(42)12-8-4)27(13-34)44-15-24(36)18-47-30(40)10-6-2/h5-13,23-28,33,35-38H,14-22H2,1-4H3/t23?,24?,25?,26?,27-,28+,33+/m0/s1 |
| InChIKey | BHZXQFHSRRSIAW-APVQHNGDSA-N |
| XLogP | -0.72 |
| TPSA | 240.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.75 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|