C16H22O6 — CID 101312278
[3-[(Z)-but-2-enoyl]oxy-2-[[(Z)-but-2-enoyl]oxymethyl]propyl] (Z)-but-2-enoate (PubChem CID 101312278) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is [3-[(Z)-but-2-enoyl]oxy-2-[[(Z)-but-2-enoyl]oxymethyl]propyl] (Z)-but-2-enoate.
| Compound Name | [3-[(Z)-but-2-enoyl]oxy-2-[[(Z)-but-2-enoyl]oxymethyl]propyl] (Z)-but-2-enoate |
|---|---|
| PubChem CID | 101312278 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [3-[(Z)-but-2-enoyl]oxy-2-[[(Z)-but-2-enoyl]oxymethyl]propyl] (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)OCC(COC(=O)/C=C\C)COC(=O)/C=C\C |
| InChI | InChI=1S/C16H22O6/c1-4-7-14(17)20-10-13(11-21-15(18)8-5-2)12-22-16(19)9-6-3/h4-9,13H,10-12H2,1-3H3/b7-4-,8-5-,9-6- |
| InChIKey | QKOJXTAAXSDQGL-PXLQOLDUSA-N |
| XLogP | 1.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|