C33H52O16 — CID 141469566
[3-[3-(3-but-2-enoyloxy-2-hydroxypropoxy)-2,2-bis[(3-but-2-enoyloxy-2-hydroxypropoxy)methyl]propoxy]-2-hydroxypropyl] but-2-enoate (PubChem CID 141469566) has the molecular formula C33H52O16 and a molecular weight of 704.76 g/mol. Its IUPAC name is [3-[3-(3-but-2-enoyloxy-2-hydroxypropoxy)-2,2-bis[(3-but-2-enoyloxy-2-hydroxypropoxy)methyl]propoxy]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[3-(3-but-2-enoyloxy-2-hydroxypropoxy)-2,2-bis[(3-but-2-enoyloxy-2-hydroxypropoxy)methyl]propoxy]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 141469566 |
| Molecular Formula | C33H52O16 |
| Molecular Weight | 704.76 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | [3-[3-(3-but-2-enoyloxy-2-hydroxypropoxy)-2,2-bis[(3-but-2-enoyloxy-2-hydroxypropoxy)methyl]propoxy]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COCC(COCC(O)COC(=O)C=CC)(COCC(O)COC(=O)C=CC)COCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C33H52O16/c1-5-9-29(38)46-17-25(34)13-42-21-33(22-43-14-26(35)18-47-30(39)10-6-2,23-44-15-27(36)19-48-31(40)11-7-3)24-45-16-28(37)20-49-32(41)12-8-4/h5-12,25-28,34-37H,13-24H2,1-4H3 |
| InChIKey | IAHBUGIAQUATRM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 223.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.76 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|