C13H26INO3 — CID 141251217
(3-but-2-enoyloxy-2-hydroxypropyl)-triethylazanium iodide (PubChem CID 141251217) has the molecular formula C13H26INO3 and a molecular weight of 371.26 g/mol. Its IUPAC name is (3-but-2-enoyloxy-2-hydroxypropyl)-triethylazanium iodide.
| Compound Name | (3-but-2-enoyloxy-2-hydroxypropyl)-triethylazanium iodide |
|---|---|
| PubChem CID | 141251217 |
| Molecular Formula | C13H26INO3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (3-but-2-enoyloxy-2-hydroxypropyl)-triethylazanium iodide |
| SMILES | CC=CC(=O)OCC(O)C[N+](CC)(CC)CC.[I-] |
| InChI | InChI=1S/C13H26NO3.HI/c1-5-9-13(16)17-11-12(15)10-14(6-2,7-3)8-4;/h5,9,12,15H,6-8,10-11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZQACBXHDGAKBHC-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|