C16H22O3 — CID 174870803
[2-hydroxy-3-(4-propylphenyl)propyl] but-2-enoate (PubChem CID 174870803) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is [2-hydroxy-3-(4-propylphenyl)propyl] but-2-enoate.
| Compound Name | [2-hydroxy-3-(4-propylphenyl)propyl] but-2-enoate |
|---|---|
| PubChem CID | 174870803 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [2-hydroxy-3-(4-propylphenyl)propyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)Cc1ccc(CCC)cc1 |
| InChI | InChI=1S/C16H22O3/c1-3-5-13-7-9-14(10-8-13)11-15(17)12-19-16(18)6-4-2/h4,6-10,15,17H,3,5,11-12H2,1-2H3 |
| InChIKey | BZOLEDXJBIPCHC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|