C9H18INO3 — CID 141251209
(3-but-2-enoyloxy-2-hydroxypropyl)-dimethylazanium iodide (PubChem CID 141251209) has the molecular formula C9H18INO3 and a molecular weight of 315.15 g/mol. Its IUPAC name is (3-but-2-enoyloxy-2-hydroxypropyl)-dimethylazanium iodide.
| Compound Name | (3-but-2-enoyloxy-2-hydroxypropyl)-dimethylazanium iodide |
|---|---|
| PubChem CID | 141251209 |
| Molecular Formula | C9H18INO3 |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (3-but-2-enoyloxy-2-hydroxypropyl)-dimethylazanium iodide |
| SMILES | CC=CC(=O)OCC(O)C[NH+](C)C.[I-] |
| InChI | InChI=1S/C9H17NO3.HI/c1-4-5-9(12)13-7-8(11)6-10(2)3;/h4-5,8,11H,6-7H2,1-3H3;1H |
| InChIKey | HSINCECFCOSSRD-UHFFFAOYSA-N |
| XLogP | -4.38 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|