C18H30O8 — CID 57242154
[3-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)butoxy]-2-hydroxypropyl] but-2-enoate (PubChem CID 57242154) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is [3-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)butoxy]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)butoxy]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 57242154 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [3-[4-(3-but-2-enoyloxy-2-hydroxypropoxy)butoxy]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COCCCCOCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C18H30O8/c1-3-7-17(21)25-13-15(19)11-23-9-5-6-10-24-12-16(20)14-26-18(22)8-4-2/h3-4,7-8,15-16,19-20H,5-6,9-14H2,1-2H3 |
| InChIKey | ZRNWKJAYWLAOLE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|