C16H36O6Si3 — CID 123192869
[3-[3-bis(trimethylsilyloxy)silylpropoxy]-2-hydroxypropyl] but-2-enoate (PubChem CID 123192869) has the molecular formula C16H36O6Si3 and a molecular weight of 408.72 g/mol. Its IUPAC name is [3-[3-bis(trimethylsilyloxy)silylpropoxy]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[3-bis(trimethylsilyloxy)silylpropoxy]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 123192869 |
| Molecular Formula | C16H36O6Si3 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [3-[3-bis(trimethylsilyloxy)silylpropoxy]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COCCC[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O6Si3/c1-8-10-16(18)20-14-15(17)13-19-11-9-12-23(21-24(2,3)4)22-25(5,6)7/h8,10,15,17,23H,9,11-14H2,1-7H3 |
| InChIKey | ZDNRVFJUKRZINF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|