C17H28O8 — CID 57016546
[3-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)propoxy]-2-hydroxypropyl] but-2-enoate (PubChem CID 57016546) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is [3-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)propoxy]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)propoxy]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 57016546 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [3-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)propoxy]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COCC(C)OCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C17H28O8/c1-4-6-16(20)24-11-14(18)9-22-8-13(3)23-10-15(19)12-25-17(21)7-5-2/h4-7,13-15,18-19H,8-12H2,1-3H3 |
| InChIKey | IBBWSODYFSKCIJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|