C17H29NO6 — CID 141067910
[3-[(3-but-2-enoyloxy-2-hydroxypropyl)-propan-2-ylamino]-2-hydroxypropyl] but-2-enoate (PubChem CID 141067910) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is [3-[(3-but-2-enoyloxy-2-hydroxypropyl)-propan-2-ylamino]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[(3-but-2-enoyloxy-2-hydroxypropyl)-propan-2-ylamino]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 141067910 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [3-[(3-but-2-enoyloxy-2-hydroxypropyl)-propan-2-ylamino]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)CN(CC(O)COC(=O)C=CC)C(C)C |
| InChI | InChI=1S/C17H29NO6/c1-5-7-16(21)23-11-14(19)9-18(13(3)4)10-15(20)12-24-17(22)8-6-2/h5-8,13-15,19-20H,9-12H2,1-4H3 |
| InChIKey | WZYWNHOFTTWPHW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|