C17H32O8 — CID 160776856
[2-hydroxy-3-[5-(2-hydroxy-3-propanoyloxypropoxy)pentoxy]propyl] propanoate (PubChem CID 160776856) has the molecular formula C17H32O8 and a molecular weight of 364.44 g/mol. Its IUPAC name is [2-hydroxy-3-[5-(2-hydroxy-3-propanoyloxypropoxy)pentoxy]propyl] propanoate.
| Compound Name | [2-hydroxy-3-[5-(2-hydroxy-3-propanoyloxypropoxy)pentoxy]propyl] propanoate |
|---|---|
| PubChem CID | 160776856 |
| Molecular Formula | C17H32O8 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [2-hydroxy-3-[5-(2-hydroxy-3-propanoyloxypropoxy)pentoxy]propyl] propanoate |
| SMILES | CCC(=O)OCC(O)COCCCCCOCC(O)COC(=O)CC |
| InChI | InChI=1S/C17H32O8/c1-3-16(20)24-12-14(18)10-22-8-6-5-7-9-23-11-15(19)13-25-17(21)4-2/h14-15,18-19H,3-13H2,1-2H3 |
| InChIKey | SABBAVUDPQILLD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|