C9H18O5 — CID 121335486
(3-butoxy-2-hydroxypropyl) 2-hydroxyacetate (PubChem CID 121335486) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3-butoxy-2-hydroxypropyl) 2-hydroxyacetate.
| Compound Name | (3-butoxy-2-hydroxypropyl) 2-hydroxyacetate |
|---|---|
| PubChem CID | 121335486 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (3-butoxy-2-hydroxypropyl) 2-hydroxyacetate |
| SMILES | CCCCOCC(O)COC(=O)CO |
| InChI | InChI=1S/C9H18O5/c1-2-3-4-13-6-8(11)7-14-9(12)5-10/h8,10-11H,2-7H2,1H3 |
| InChIKey | CRGROAWENRVECM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|