About (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate
(2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate (PubChem CID 91017157) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate.
Molecular Properties
| Compound Name | (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate |
| PubChem CID | 91017157 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate |
| SMILES | CCC(=O)OCC(O)COC(=O)C(C)CC |
| InChI | InChI=1S/C11H20O5/c1-4-8(3)11(14)16-7-9(12)6-15-10(13)5-2/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | BDWLVODKQMICFO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate?
The IUPAC name of (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate (CID 91017157) is (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate.
What is the SMILES notation for (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate?
The canonical SMILES for (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate is CCC(=O)OCC(O)COC(=O)C(C)CC.
What is the InChIKey of (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate?
The InChIKey is BDWLVODKQMICFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-4-8(3)11(14)16-7-9(12)6-15-10(13)5-2/h8-9,12H,4-7H2,1-3H3.
What are the key properties of (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate?
(2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate has a molecular weight of 232.28 g/mol, XLogP of 0.89, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-3-propanoyloxypropyl) 2-methylbutanoate is sourced from PubChem (CID 91017157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).