C12H22O5 — CID 140925910
(2-hydroxy-3-propanoyloxypropyl) 2,2-dimethylbutanoate (PubChem CID 140925910) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (2-hydroxy-3-propanoyloxypropyl) 2,2-dimethylbutanoate.
| Compound Name | (2-hydroxy-3-propanoyloxypropyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 140925910 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2-hydroxy-3-propanoyloxypropyl) 2,2-dimethylbutanoate |
| SMILES | CCC(=O)OCC(O)COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H22O5/c1-5-10(14)16-7-9(13)8-17-11(15)12(3,4)6-2/h9,13H,5-8H2,1-4H3 |
| InChIKey | XGHCEHZZPZUNAK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |