C21H38O9 — CID 157133571
2,3-dihydroxypropyl 2,2-dimethylbutanoate;2-(3-oxobutanoyloxy)ethyl 2,2-dimethylbutanoate (PubChem CID 157133571) has the molecular formula C21H38O9 and a molecular weight of 434.53 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2,2-dimethylbutanoate;2-(3-oxobutanoyloxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2,3-dihydroxypropyl 2,2-dimethylbutanoate;2-(3-oxobutanoyloxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 157133571 |
| Molecular Formula | C21H38O9 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2,3-dihydroxypropyl 2,2-dimethylbutanoate;2-(3-oxobutanoyloxy)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(O)CO.CCC(C)(C)C(=O)OCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C12H20O5.C9H18O4/c1-5-12(3,4)11(15)17-7-6-16-10(14)8-9(2)13;1-4-9(2,3)8(12)13-6-7(11)5-10/h5-8H2,1-4H3;7,10-11H,4-6H2,1-3H3 |
| InChIKey | AJIVXBPVDTXOTM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|