C11H24N2O3 — CID 153430114
[3-(2-aminoethylamino)-2-hydroxypropyl] 2,2-dimethylbutanoate (PubChem CID 153430114) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is [3-(2-aminoethylamino)-2-hydroxypropyl] 2,2-dimethylbutanoate.
| Compound Name | [3-(2-aminoethylamino)-2-hydroxypropyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 153430114 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | [3-(2-aminoethylamino)-2-hydroxypropyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(O)CNCCN |
| InChI | InChI=1S/C11H24N2O3/c1-4-11(2,3)10(15)16-8-9(14)7-13-6-5-12/h9,13-14H,4-8,12H2,1-3H3 |
| InChIKey | VMGIUQUPRVVQCP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|