C19H41NO6Si — CID 140930187
[2-hydroxy-3-(3-trimethoxysilylpropylamino)propyl] 2-methyl-2-propylhexanoate (PubChem CID 140930187) has the molecular formula C19H41NO6Si and a molecular weight of 407.62 g/mol. Its IUPAC name is [2-hydroxy-3-(3-trimethoxysilylpropylamino)propyl] 2-methyl-2-propylhexanoate.
| Compound Name | [2-hydroxy-3-(3-trimethoxysilylpropylamino)propyl] 2-methyl-2-propylhexanoate |
|---|---|
| PubChem CID | 140930187 |
| Molecular Formula | C19H41NO6Si |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | [2-hydroxy-3-(3-trimethoxysilylpropylamino)propyl] 2-methyl-2-propylhexanoate |
| SMILES | CCCCC(C)(CCC)C(=O)OCC(O)CNCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C19H41NO6Si/c1-7-9-12-19(3,11-8-2)18(22)26-16-17(21)15-20-13-10-14-27(23-4,24-5)25-6/h17,20-21H,7-16H2,1-6H3 |
| InChIKey | KWZGPIYHQGRHFD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|