C17H42N2O8Si2 — CID 20741051
1-(3-trimethoxysilylpropoxy)-3-[2-(3-trimethoxysilylpropylamino)ethylamino]propan-2-ol (PubChem CID 20741051) has the molecular formula C17H42N2O8Si2 and a molecular weight of 458.70 g/mol. Its IUPAC name is 1-(3-trimethoxysilylpropoxy)-3-[2-(3-trimethoxysilylpropylamino)ethylamino]propan-2-ol.
| Compound Name | 1-(3-trimethoxysilylpropoxy)-3-[2-(3-trimethoxysilylpropylamino)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 20741051 |
| Molecular Formula | C17H42N2O8Si2 |
| Molecular Weight | 458.70 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1-(3-trimethoxysilylpropoxy)-3-[2-(3-trimethoxysilylpropylamino)ethylamino]propan-2-ol |
| SMILES | CO[Si](CCCNCCNCC(O)COCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C17H42N2O8Si2/c1-21-28(22-2,23-3)13-7-9-18-10-11-19-15-17(20)16-27-12-8-14-29(24-4,25-5)26-6/h17-20H,7-16H2,1-6H3 |
| InChIKey | FJBBHCYRBVQYFF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.70 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|