C68H160N4O24Si9 — CID 101498166
tetrakis[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]propyl-dimethylsilyl] silicate (PubChem CID 101498166) has the molecular formula C68H160N4O24Si9 and a molecular weight of 1670.81 g/mol. Its IUPAC name is tetrakis[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]propyl-dimethylsilyl] silicate.
| Compound Name | tetrakis[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]propyl-dimethylsilyl] silicate |
|---|---|
| PubChem CID | 101498166 |
| Molecular Formula | C68H160N4O24Si9 |
| Molecular Weight | 1670.81 g/mol |
| Exact Mass | 1668.93 |
| IUPAC Name | tetrakis[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]propyl-dimethylsilyl] silicate |
| SMILES | CCO[Si](CCCNCC(O)COCCC[Si](C)(C)O[Si](O[Si](C)(C)CCCOCC(O)CNCCC[Si](OCC)(OCC)OCC)(O[Si](C)(C)CCCOCC(O)CNCCC[Si](OCC)(OCC)OCC)O[Si](C)(C)CCCOCC(O)CNCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C68H160N4O24Si9/c1-21-81-101(82-22-2,83-23-3)53-33-41-69-57-65(73)61-77-45-37-49-97(13,14)93-105(94-98(15,16)50-38-46-78-62-66(74)58-70-42-34-54-102(84-24-4,85-25-5)86-26-6,95-99(17,18)51-39-47-79-63-67(75)59-71-43-35-55-103(87-27-7,88-28-8)89-29-9)96-100(19,20)52-40-48-80-64-68(76)60-72-44-36-56-104(90-30-10,91-31-11)92-32-12/h65-76H,21-64H2,1-20H3 |
| InChIKey | VFJFKHSHQTVBSV-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 313.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 80 |
| Heavy Atoms | 105 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1670.81 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|