C23H49NO11Si2 — CID 87800382
[2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] prop-2-enoate;3-trimethoxysilylpropyl acetate (PubChem CID 87800382) has the molecular formula C23H49NO11Si2 and a molecular weight of 571.81 g/mol. Its IUPAC name is [2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] prop-2-enoate;3-trimethoxysilylpropyl acetate.
| Compound Name | [2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] prop-2-enoate;3-trimethoxysilylpropyl acetate |
|---|---|
| PubChem CID | 87800382 |
| Molecular Formula | C23H49NO11Si2 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | [2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] prop-2-enoate;3-trimethoxysilylpropyl acetate |
| SMILES | C=CC(=O)OCC(O)CNCCC[Si](OCC)(OCC)OCC.CO[Si](CCCOC(C)=O)(OC)OC |
| InChI | InChI=1S/C15H31NO6Si.C8H18O5Si/c1-5-15(18)19-13-14(17)12-16-10-9-11-23(20-6-2,21-7-3)22-8-4;1-8(9)13-6-5-7-14(10-2,11-3)12-4/h5,14,16-17H,1,6-13H2,2-4H3;5-7H2,1-4H3 |
| InChIKey | IKAMAPBBRLASNE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|