C25H56N2O9Si2 — CID 87852488
N-ethyl-2-methyl-1-trimethoxysilylpropan-1-amine;[2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] 2-methylprop-2-enoate (PubChem CID 87852488) has the molecular formula C25H56N2O9Si2 and a molecular weight of 584.90 g/mol. Its IUPAC name is N-ethyl-2-methyl-1-trimethoxysilylpropan-1-amine;[2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] 2-methylprop-2-enoate.
| Compound Name | N-ethyl-2-methyl-1-trimethoxysilylpropan-1-amine;[2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87852488 |
| Molecular Formula | C25H56N2O9Si2 |
| Molecular Weight | 584.90 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | N-ethyl-2-methyl-1-trimethoxysilylpropan-1-amine;[2-hydroxy-3-(3-triethoxysilylpropylamino)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CNCCC[Si](OCC)(OCC)OCC.CCNC(C(C)C)[Si](OC)(OC)OC |
| InChI | InChI=1S/C16H33NO6Si.C9H23NO3Si/c1-6-21-24(22-7-2,23-8-3)11-9-10-17-12-15(18)13-20-16(19)14(4)5;1-7-10-9(8(2)3)14(11-4,12-5)13-6/h15,17-18H,4,6-13H2,1-3,5H3;8-10H,7H2,1-6H3 |
| InChIKey | KBBZRYQIRXIIJW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|