C10H20NO3PS — CID 134373212
[2-hydroxy-3-(2-methylphosphanylsulfanylethylamino)propyl] 2-methylprop-2-enoate (PubChem CID 134373212) has the molecular formula C10H20NO3PS and a molecular weight of 265.31 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylphosphanylsulfanylethylamino)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-(2-methylphosphanylsulfanylethylamino)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134373212 |
| Molecular Formula | C10H20NO3PS |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [2-hydroxy-3-(2-methylphosphanylsulfanylethylamino)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CNCCSPC |
| InChI | InChI=1S/C10H20NO3PS/c1-8(2)10(13)14-7-9(12)6-11-4-5-16-15-3/h9,11-12,15H,1,4-7H2,2-3H3 |
| InChIKey | VWCFACWKSMJAGE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|