C9H16N2O5 — CID 139935856
[2-hydroxy-3-(2-methoxycarbonylhydrazinyl)propyl] 2-methylprop-2-enoate (PubChem CID 139935856) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methoxycarbonylhydrazinyl)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-(2-methoxycarbonylhydrazinyl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139935856 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | [2-hydroxy-3-(2-methoxycarbonylhydrazinyl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CNNC(=O)OC |
| InChI | InChI=1S/C9H16N2O5/c1-6(2)8(13)16-5-7(12)4-10-11-9(14)15-3/h7,10,12H,1,4-5H2,2-3H3,(H,11,14) |
| InChIKey | PGTLXSGANMHEGS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|