C11H18O5 — CID 87196210
2-hydroxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 87196210) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-hydroxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | 2-hydroxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87196210 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-hydroxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCC(C)O |
| InChI | InChI=1S/C7H12O3.C4H6O2/c1-5(2)7(9)10-4-6(3)8;1-3(2)4(5)6/h6,8H,1,4H2,2-3H3;1H2,2H3,(H,5,6) |
| InChIKey | SGIIOANHPUIACV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|