C16H22O8Zn — CID 160963047
zinc bis(2-methyl-3-(2-methylprop-2-enoyloxy)propanoate) (PubChem CID 160963047) has the molecular formula C16H22O8Zn and a molecular weight of 407.73 g/mol. Its IUPAC name is zinc bis(2-methyl-3-(2-methylprop-2-enoyloxy)propanoate).
| Compound Name | zinc bis(2-methyl-3-(2-methylprop-2-enoyloxy)propanoate) |
|---|---|
| PubChem CID | 160963047 |
| Molecular Formula | C16H22O8Zn |
| Molecular Weight | 407.73 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | zinc bis(2-methyl-3-(2-methylprop-2-enoyloxy)propanoate) |
| SMILES | C=C(C)C(=O)OCC(C)C(=O)[O-].C=C(C)C(=O)OCC(C)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C8H12O4.Zn/c2*1-5(2)8(11)12-4-6(3)7(9)10;/h2*6H,1,4H2,2-3H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | SXGGADGHSKSGGC-UHFFFAOYSA-L |
| XLogP | -1.02 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.73 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|