About ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+)
ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) (PubChem CID 20605307) has the molecular formula C10H18O2W
and a molecular weight of 354.09 g/mol. Its IUPAC name is ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+).
Molecular Properties
| Compound Name | ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) |
| PubChem CID | 20605307 |
| Molecular Formula | C10H18O2W |
| Molecular Weight | 354.09 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) |
| SMILES | C=C(C)C(=O)OCC([CH2-])C.[CH2-]C.[W+2] |
| InChI | InChI=1S/C8H13O2.C2H5.W/c1-6(2)5-10-8(9)7(3)4;1-2;/h6H,1,3,5H2,2,4H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | BBEOAGCJHISURX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.09 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+)?
The IUPAC name of ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) (CID 20605307) is ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+).
What is the SMILES notation for ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+)?
The canonical SMILES for ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) is C=C(C)C(=O)OCC([CH2-])C.[CH2-]C.[W+2].
What is the InChIKey of ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+)?
The InChIKey is BBEOAGCJHISURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O2.C2H5.W/c1-6(2)5-10-8(9)7(3)4;1-2;/h6H,1,3,5H2,2,4H3;1H2,2H3;/q2*-1;+2.
What are the key properties of ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+)?
ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) has a molecular weight of 354.09 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methanidylpropyl 2-methylprop-2-enoate;tungsten(2+) is sourced from PubChem (CID 20605307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).