About butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate
butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate (PubChem CID 59117787) has the molecular formula C13H22FeO2
and a molecular weight of 266.16 g/mol. Its IUPAC name is butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate |
| PubChem CID | 59117787 |
| Molecular Formula | C13H22FeO2 |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC([CH2-])C[CH2-].[CH2-]CC[CH2-].[Fe+4] |
| InChI | InChI=1S/C9H14O2.C4H8.Fe/c1-5-8(4)6-11-9(10)7(2)3;1-3-4-2;/h8H,1-2,4-6H2,3H3;1-4H2;/q2*-2;+4 |
| InChIKey | ZJFPKCGTJUZWGN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate?
The IUPAC name of butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate (CID 59117787) is butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate.
What is the SMILES notation for butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate?
The canonical SMILES for butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC([CH2-])C[CH2-].[CH2-]CC[CH2-].[Fe+4].
What is the InChIKey of butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate?
The InChIKey is ZJFPKCGTJUZWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C4H8.Fe/c1-5-8(4)6-11-9(10)7(2)3;1-3-4-2;/h8H,1-2,4-6H2,3H3;1-4H2;/q2*-2;+4.
What are the key properties of butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate?
butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate has a molecular weight of 266.16 g/mol, XLogP of 3.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;iron(4+);2-methanidylbutyl 2-methylprop-2-enoate is sourced from PubChem (CID 59117787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).