About magnesium bis(ethyl 2-methylprop-2-enoate)
magnesium bis(ethyl 2-methylprop-2-enoate) (PubChem CID 174920026) has the molecular formula C12H18MgO4
and a molecular weight of 250.58 g/mol. Its IUPAC name is magnesium bis(ethyl 2-methylprop-2-enoate).
Molecular Properties
| Compound Name | magnesium bis(ethyl 2-methylprop-2-enoate) |
| PubChem CID | 174920026 |
| Molecular Formula | C12H18MgO4 |
| Molecular Weight | 250.58 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | magnesium bis(ethyl 2-methylprop-2-enoate) |
| SMILES | C=C(C)C(=O)OC[CH2-].C=C(C)C(=O)OC[CH2-].[Mg+2] |
| InChI | InChI=1S/2C6H9O2.Mg/c2*1-4-8-6(7)5(2)3;/h2*1-2,4H2,3H3;/q2*-1;+2 |
| InChIKey | DARXXTCHLRFOLW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.58 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(ethyl 2-methylprop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(ethyl 2-methylprop-2-enoate)?
The IUPAC name of magnesium bis(ethyl 2-methylprop-2-enoate) (CID 174920026) is magnesium bis(ethyl 2-methylprop-2-enoate).
What is the SMILES notation for magnesium bis(ethyl 2-methylprop-2-enoate)?
The canonical SMILES for magnesium bis(ethyl 2-methylprop-2-enoate) is C=C(C)C(=O)OC[CH2-].C=C(C)C(=O)OC[CH2-].[Mg+2].
What is the InChIKey of magnesium bis(ethyl 2-methylprop-2-enoate)?
The InChIKey is DARXXTCHLRFOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H9O2.Mg/c2*1-4-8-6(7)5(2)3;/h2*1-2,4H2,3H3;/q2*-1;+2.
What are the key properties of magnesium bis(ethyl 2-methylprop-2-enoate)?
magnesium bis(ethyl 2-methylprop-2-enoate) has a molecular weight of 250.58 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(ethyl 2-methylprop-2-enoate) is sourced from PubChem (CID 174920026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).