About azane;hydroxymethyl 2-methylprop-2-enoate
azane;hydroxymethyl 2-methylprop-2-enoate (PubChem CID 172791973) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is azane;hydroxymethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | azane;hydroxymethyl 2-methylprop-2-enoate |
| PubChem CID | 172791973 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | azane;hydroxymethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCO.N |
| InChI | InChI=1S/C5H8O3.H3N/c1-4(2)5(7)8-3-6;/h6H,1,3H2,2H3;1H3 |
| InChIKey | SKGWHNLWYXWXFN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;hydroxymethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydroxymethyl 2-methylprop-2-enoate?
The IUPAC name of azane;hydroxymethyl 2-methylprop-2-enoate (CID 172791973) is azane;hydroxymethyl 2-methylprop-2-enoate.
What is the SMILES notation for azane;hydroxymethyl 2-methylprop-2-enoate?
The canonical SMILES for azane;hydroxymethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCO.N.
What is the InChIKey of azane;hydroxymethyl 2-methylprop-2-enoate?
The InChIKey is SKGWHNLWYXWXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.H3N/c1-4(2)5(7)8-3-6;/h6H,1,3H2,2H3;1H3.
What are the key properties of azane;hydroxymethyl 2-methylprop-2-enoate?
azane;hydroxymethyl 2-methylprop-2-enoate has a molecular weight of 133.15 g/mol, XLogP of 0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydroxymethyl 2-methylprop-2-enoate is sourced from PubChem (CID 172791973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).