C10H19NO3 — CID 57254396
[2-(diethylamino)-2-hydroxyethyl] 2-methylprop-2-enoate (PubChem CID 57254396) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is [2-(diethylamino)-2-hydroxyethyl] 2-methylprop-2-enoate.
| Compound Name | [2-(diethylamino)-2-hydroxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57254396 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | [2-(diethylamino)-2-hydroxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)N(CC)CC |
| InChI | InChI=1S/C10H19NO3/c1-5-11(6-2)9(12)7-14-10(13)8(3)4/h9,12H,3,5-7H2,1-2,4H3 |
| InChIKey | UWHIODUDORESFB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|