C10H20N2O2 — CID 141211213
[2-amino-2-(tert-butylamino)ethyl] 2-methylprop-2-enoate (PubChem CID 141211213) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is [2-amino-2-(tert-butylamino)ethyl] 2-methylprop-2-enoate.
| Compound Name | [2-amino-2-(tert-butylamino)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141211213 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | [2-amino-2-(tert-butylamino)ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(N)NC(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-7(2)9(13)14-6-8(11)12-10(3,4)5/h8,12H,1,6,11H2,2-5H3 |
| InChIKey | FHZSZPPXLNJNKL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|