C11H21NO2 — CID 18325515
1-(tert-butylamino)propyl 2-methylprop-2-enoate (PubChem CID 18325515) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 1-(tert-butylamino)propyl 2-methylprop-2-enoate.
| Compound Name | 1-(tert-butylamino)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18325515 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 1-(tert-butylamino)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)NC(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-7-9(12-11(4,5)6)14-10(13)8(2)3/h9,12H,2,7H2,1,3-6H3 |
| InChIKey | OPCOEQMBJOXLHG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|