C8H16N2O2 — CID 54104991
1,2-bis(methylamino)ethyl 2-methylprop-2-enoate (PubChem CID 54104991) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 1,2-bis(methylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 1,2-bis(methylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54104991 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 1,2-bis(methylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CNC)NC |
| InChI | InChI=1S/C8H16N2O2/c1-6(2)8(11)12-7(10-4)5-9-3/h7,9-10H,1,5H2,2-4H3 |
| InChIKey | NDCUUCLRVLQFQW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|