C14H23NO4 — CID 22750442
[2-(tert-butylamino)-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate (PubChem CID 22750442) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate.
| Compound Name | [2-(tert-butylamino)-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22750442 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [2-(tert-butylamino)-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(NC(C)(C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C14H23NO4/c1-9(2)12(16)18-8-11(15-14(5,6)7)19-13(17)10(3)4/h11,15H,1,3,8H2,2,4-7H3 |
| InChIKey | ZWOLHFZRQRUHLM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|