C43H84O8 — CID 173326702
bis(ethane-1,2-diol);ethene;2-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate (PubChem CID 173326702) has the molecular formula C43H84O8 and a molecular weight of 729.14 g/mol. Its IUPAC name is bis(ethane-1,2-diol);ethene;2-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate.
| Compound Name | bis(ethane-1,2-diol);ethene;2-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173326702 |
| Molecular Formula | C43H84O8 |
| Molecular Weight | 729.14 g/mol |
| Exact Mass | 728.62 |
| IUPAC Name | bis(ethane-1,2-diol);ethene;2-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate |
| SMILES | C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C(C)C(=O)OCC(C)OC(=O)C(=C)C.OCCO.OCCO |
| InChI | InChI=1S/C11H16O4.2C2H6O2.14C2H4/c1-7(2)10(12)14-6-9(5)15-11(13)8(3)4;2*3-1-2-4;14*1-2/h9H,1,3,6H2,2,4-5H3;2*3-4H,1-2H2;14*1-2H2 |
| InChIKey | CHTNFEPFLJHOMS-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.14 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|