C29H46O10 — CID 87844195
1-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]propoxy]propyl 2-methylprop-2-enoate (PubChem CID 87844195) has the molecular formula C29H46O10 and a molecular weight of 554.68 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]propoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 1-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]propoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87844195 |
| Molecular Formula | C29H46O10 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | 1-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;2-[2-[2-(2-methylprop-2-enoyloxy)propoxy]propoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)OC(=O)C(=C)C.C=C(C)C(=O)OCC(C)OCC(C)OCC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H28O6.C12H18O4/c1-11(2)16(18)22-9-14(6)20-8-13(5)21-10-15(7)23-17(19)12(3)4;1-6-7-10(15-11(13)8(2)3)16-12(14)9(4)5/h13-15H,1,3,8-10H2,2,4-7H3;10H,2,4,6-7H2,1,3,5H3 |
| InChIKey | MUHQVOFFJIEGOJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|