C13H24O5 — CID 19734689
1-[1-(1-hydroxypropan-2-yloxy)propan-2-yloxy]propan-2-yl 2-methylprop-2-enoate (PubChem CID 19734689) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is 1-[1-(1-hydroxypropan-2-yloxy)propan-2-yloxy]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[1-(1-hydroxypropan-2-yloxy)propan-2-yloxy]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19734689 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-[1-(1-hydroxypropan-2-yloxy)propan-2-yloxy]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)COC(C)COC(C)CO |
| InChI | InChI=1S/C13H24O5/c1-9(2)13(15)18-12(5)8-17-11(4)7-16-10(3)6-14/h10-12,14H,1,6-8H2,2-5H3 |
| InChIKey | KNZAWAUXMAFYDP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|