C11H18O7 — CID 174487029
butanedioic acid;1-hydroxypropan-2-yl 2-methylprop-2-enoate (PubChem CID 174487029) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is butanedioic acid;1-hydroxypropan-2-yl 2-methylprop-2-enoate.
| Compound Name | butanedioic acid;1-hydroxypropan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174487029 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | butanedioic acid;1-hydroxypropan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CO.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C7H12O3.C4H6O4/c1-5(2)7(9)10-6(3)4-8;5-3(6)1-2-4(7)8/h6,8H,1,4H2,2-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | QFAPLLNQXOZIFC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|