C11H19O6P — CID 58974134
3-[methyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid (PubChem CID 58974134) has the molecular formula C11H19O6P and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-[methyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid.
| Compound Name | 3-[methyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 58974134 |
| Molecular Formula | C11H19O6P |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-[methyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid |
| SMILES | C=C(C)C(=O)OC(C)COP(C)(=O)CCC(=O)O |
| InChI | InChI=1S/C11H19O6P/c1-8(2)11(14)17-9(3)7-16-18(4,15)6-5-10(12)13/h9H,1,5-7H2,2-4H3,(H,12,13) |
| InChIKey | OUGVXBIWNUWWCX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|