C21H33O9P — CID 139653960
1-[bis[2-(2-methylprop-2-enoyloxy)propoxy]phosphanyloxy]propan-2-yl 2-methylprop-2-enoate (PubChem CID 139653960) has the molecular formula C21H33O9P and a molecular weight of 460.46 g/mol. Its IUPAC name is 1-[bis[2-(2-methylprop-2-enoyloxy)propoxy]phosphanyloxy]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[bis[2-(2-methylprop-2-enoyloxy)propoxy]phosphanyloxy]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139653960 |
| Molecular Formula | C21H33O9P |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[bis[2-(2-methylprop-2-enoyloxy)propoxy]phosphanyloxy]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)COP(OCC(C)OC(=O)C(=C)C)OCC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C21H33O9P/c1-13(2)19(22)28-16(7)10-25-31(26-11-17(8)29-20(23)14(3)4)27-12-18(9)30-21(24)15(5)6/h16-18H,1,3,5,10-12H2,2,4,6-9H3 |
| InChIKey | YREPWYGKFUCMCK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|