C7H12O2S2 — CID 174221047
1-(disulfanyl)propan-2-yl 2-methylprop-2-enoate (PubChem CID 174221047) has the molecular formula C7H12O2S2 and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-(disulfanyl)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-(disulfanyl)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174221047 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 1-(disulfanyl)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CSS |
| InChI | InChI=1S/C7H12O2S2/c1-5(2)7(8)9-6(3)4-11-10/h6,10H,1,4H2,2-3H3 |
| InChIKey | RVFWINAHNNDBIL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|